C17H18N4O3 — CID 50961222
(3aS,6aS)-5-(2-methyl-1,6-naphthyridine-3-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 50961222) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is (3aS,6aS)-5-(2-methyl-1,6-naphthyridine-3-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-(2-methyl-1,6-naphthyridine-3-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 50961222 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3aS,6aS)-5-(2-methyl-1,6-naphthyridine-3-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1nc2ccncc2cc1C(=O)N1C[C@@H]2CNC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H18N4O3/c1-10-13(4-11-5-18-3-2-14(11)20-10)15(22)21-7-12-6-19-8-17(12,9-21)16(23)24/h2-5,12,19H,6-9H2,1H3,(H,23,24)/t12-,17-/m0/s1 |
| InChIKey | RNTGXTGBLIYLDK-SJCJKPOMSA-N |
| XLogP | 0.68 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |