C16H24N6O — CID 50961389
4-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine (PubChem CID 50961389) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine.
| Compound Name | 4-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 50961389 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-N,2-N-dimethyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
| SMILES | COCc1cc(CNc2nc(N(C)C)nc3c2CCCC3)[nH]n1 |
| InChI | InChI=1S/C16H24N6O/c1-22(2)16-18-14-7-5-4-6-13(14)15(19-16)17-9-11-8-12(10-23-3)21-20-11/h8H,4-7,9-10H2,1-3H3,(H,20,21)(H,17,18,19) |
| InChIKey | YGYSBQNVZWEQBE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |