C14H27N3O3S2 — CID 50961657
(3aR,6aR)-N-(2-tert-butylsulfanylethyl)-5-methylsulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50961657) has the molecular formula C14H27N3O3S2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (3aR,6aR)-N-(2-tert-butylsulfanylethyl)-5-methylsulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-(2-tert-butylsulfanylethyl)-5-methylsulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50961657 |
| Molecular Formula | C14H27N3O3S2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3aR,6aR)-N-(2-tert-butylsulfanylethyl)-5-methylsulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)[C@@]12CNC[C@@H]1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C14H27N3O3S2/c1-13(2,3)21-6-5-16-12(18)14-9-15-7-11(14)8-17(10-14)22(4,19)20/h11,15H,5-10H2,1-4H3,(H,16,18)/t11-,14-/m1/s1 |
| InChIKey | AHTSNCFONIEWGH-BXUZGUMPSA-N |
| XLogP | 0.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|