About N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide
N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 50961689) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 50961689 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N(C)C(C)c2nccs2)no1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8(2)11-7-10(15-18-11)13(17)16(4)9(3)12-14-5-6-19-12/h5-9H,1-4H3 |
| InChIKey | PZLYSLYUSYNEOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide (CID 50961689) is N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide is CC(C)c1cc(C(=O)N(C)C(C)c2nccs2)no1.
What is the InChIKey of N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide?
The InChIKey is PZLYSLYUSYNEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-8(2)11-7-10(15-18-11)13(17)16(4)9(3)12-14-5-6-19-12/h5-9H,1-4H3.
What are the key properties of N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide?
N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide has a molecular weight of 279.37 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-propan-2-yl-N-[1-(1,3-thiazol-2-yl)ethyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 50961689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).