C23H25N3O2 — CID 50961972
N-[(2S,4R,6S)-2-benzyl-6-(1-methylimidazol-2-yl)oxan-4-yl]benzamide (PubChem CID 50961972) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[(2S,4R,6S)-2-benzyl-6-(1-methylimidazol-2-yl)oxan-4-yl]benzamide.
| Compound Name | N-[(2S,4R,6S)-2-benzyl-6-(1-methylimidazol-2-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 50961972 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(2S,4R,6S)-2-benzyl-6-(1-methylimidazol-2-yl)oxan-4-yl]benzamide |
| SMILES | Cn1ccnc1[C@@H]1C[C@H](NC(=O)c2ccccc2)C[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C23H25N3O2/c1-26-13-12-24-22(26)21-16-19(25-23(27)18-10-6-3-7-11-18)15-20(28-21)14-17-8-4-2-5-9-17/h2-13,19-21H,14-16H2,1H3,(H,25,27)/t19-,20+,21+/m1/s1 |
| InChIKey | KKNFPSBKRQIEAS-HKBOAZHASA-N |
| XLogP | 3.68 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |