C21H21F2NO2 — CID 50962025
N-[(2R,4S,6S)-2-(3,5-difluorophenyl)-6-[(E)-2-phenylethenyl]oxan-4-yl]acetamide (PubChem CID 50962025) has the molecular formula C21H21F2NO2 and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[(2R,4S,6S)-2-(3,5-difluorophenyl)-6-[(E)-2-phenylethenyl]oxan-4-yl]acetamide.
| Compound Name | N-[(2R,4S,6S)-2-(3,5-difluorophenyl)-6-[(E)-2-phenylethenyl]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50962025 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(2R,4S,6S)-2-(3,5-difluorophenyl)-6-[(E)-2-phenylethenyl]oxan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H](/C=C/c2ccccc2)O[C@@H](c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C21H21F2NO2/c1-14(25)24-19-12-20(8-7-15-5-3-2-4-6-15)26-21(13-19)16-9-17(22)11-18(23)10-16/h2-11,19-21H,12-13H2,1H3,(H,24,25)/b8-7+/t19-,20+,21+/m0/s1 |
| InChIKey | DLGQFQPXQBFWSG-NXBXPITISA-N |
| XLogP | 4.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |