C18H19ClFN3O2 — CID 50962204
N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-(1-pyridin-3-ylethyl)butanediamide (PubChem CID 50962204) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-(1-pyridin-3-ylethyl)butanediamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-(1-pyridin-3-ylethyl)butanediamide |
|---|---|
| PubChem CID | 50962204 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-(1-pyridin-3-ylethyl)butanediamide |
| SMILES | CC(c1cccnc1)N(C)C(=O)CCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-12(13-4-3-9-21-11-13)23(2)18(25)8-7-17(24)22-14-5-6-16(20)15(19)10-14/h3-6,9-12H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | HHBLPJMDPBMZCA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |