C16H22F3NO2 — CID 50962229
2-[(4-methoxyphenyl)methyl]-4-(4,4,4-trifluorobutyl)morpholine (PubChem CID 50962229) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-4-(4,4,4-trifluorobutyl)morpholine.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-4-(4,4,4-trifluorobutyl)morpholine |
|---|---|
| PubChem CID | 50962229 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-4-(4,4,4-trifluorobutyl)morpholine |
| SMILES | COc1ccc(CC2CN(CCCC(F)(F)F)CCO2)cc1 |
| InChI | InChI=1S/C16H22F3NO2/c1-21-14-5-3-13(4-6-14)11-15-12-20(9-10-22-15)8-2-7-16(17,18)19/h3-6,15H,2,7-12H2,1H3 |
| InChIKey | VOVAUYVOEJPBHL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |