C12H20FN5O3S — CID 50962616
N-[2-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-N-methylmethanesulfonamide (PubChem CID 50962616) has the molecular formula C12H20FN5O3S and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[2-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 50962616 |
| Molecular Formula | C12H20FN5O3S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[2-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-N-methylmethanesulfonamide |
| SMILES | CN(CCNc1ncc(F)c(N2CCOCC2)n1)S(C)(=O)=O |
| InChI | InChI=1S/C12H20FN5O3S/c1-17(22(2,19)20)4-3-14-12-15-9-10(13)11(16-12)18-5-7-21-8-6-18/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | FYSNAEWPRZRFDX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |