C12H17F5N2O — CID 50962805
N-[[1-(3,3,4,4,4-pentafluorobutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide (PubChem CID 50962805) has the molecular formula C12H17F5N2O and a molecular weight of 300.27 g/mol. Its IUPAC name is N-[[1-(3,3,4,4,4-pentafluorobutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide.
| Compound Name | N-[[1-(3,3,4,4,4-pentafluorobutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 50962805 |
| Molecular Formula | C12H17F5N2O |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[[1-(3,3,4,4,4-pentafluorobutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1=CCCN(CCC(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H17F5N2O/c1-9(20)18-7-10-3-2-5-19(8-10)6-4-11(13,14)12(15,16)17/h3H,2,4-8H2,1H3,(H,18,20) |
| InChIKey | GCUHWEYOOTYFBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|