About 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol
2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 50963034) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol |
| PubChem CID | 50963034 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | CCCc1cnc(C)nc1NC(CO)(CO)CO |
| InChI | InChI=1S/C12H21N3O3/c1-3-4-10-5-13-9(2)14-11(10)15-12(6-16,7-17)8-18/h5,16-18H,3-4,6-8H2,1-2H3,(H,13,14,15) |
| InChIKey | HKWOHVMCUTYXBW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol?
The IUPAC name of 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol (CID 50963034) is 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol.
What is the SMILES notation for 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol?
The canonical SMILES for 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol is CCCc1cnc(C)nc1NC(CO)(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol?
The InChIKey is HKWOHVMCUTYXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-3-4-10-5-13-9(2)14-11(10)15-12(6-16,7-17)8-18/h5,16-18H,3-4,6-8H2,1-2H3,(H,13,14,15).
What are the key properties of 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol?
2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol has a molecular weight of 255.32 g/mol, XLogP of -0.13, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-[(2-methyl-5-propylpyrimidin-4-yl)amino]propane-1,3-diol is sourced from PubChem (CID 50963034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).