C17H22FNO2 — CID 50963101
(E)-N-[(4-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)pent-3-enamide (PubChem CID 50963101) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)pent-3-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)pent-3-enamide |
|---|---|
| PubChem CID | 50963101 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)pent-3-enamide |
| SMILES | C/C=C/CC(=O)N(Cc1ccc(F)cc1)CC1CCCO1 |
| InChI | InChI=1S/C17H22FNO2/c1-2-3-6-17(20)19(13-16-5-4-11-21-16)12-14-7-9-15(18)10-8-14/h2-3,7-10,16H,4-6,11-13H2,1H3/b3-2+ |
| InChIKey | CTKWGWLIYPRXFB-NSCUHMNNSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|