About N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide
N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide (PubChem CID 50963980) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide |
| PubChem CID | 50963980 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide |
| SMILES | C=CCCN1CC=C(CCNC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H30N2O/c1-2-3-13-20-14-10-16(11-15-20)9-12-19-18(21)17-7-5-4-6-8-17/h2,10,17H,1,3-9,11-15H2,(H,19,21) |
| InChIKey | VYIJMYHASQPLLL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide?
The IUPAC name of N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide (CID 50963980) is N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide.
What is the SMILES notation for N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide?
The canonical SMILES for N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide is C=CCCN1CC=C(CCNC(=O)C2CCCCC2)CC1.
What is the InChIKey of N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide?
The InChIKey is VYIJMYHASQPLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O/c1-2-3-13-20-14-10-16(11-15-20)9-12-19-18(21)17-7-5-4-6-8-17/h2,10,17H,1,3-9,11-15H2,(H,19,21).
What are the key properties of N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide?
N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide has a molecular weight of 290.45 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-but-3-enyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]cyclohexanecarboxamide is sourced from PubChem (CID 50963980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).