C22H17F3N3PS — CID 5096428
N-diphenylphosphinothioyl-2-imidazol-1-yl-5-(trifluoromethyl)aniline (PubChem CID 5096428) has the molecular formula C22H17F3N3PS and a molecular weight of 443.43 g/mol. Its IUPAC name is N-diphenylphosphinothioyl-2-imidazol-1-yl-5-(trifluoromethyl)aniline.
| Compound Name | N-diphenylphosphinothioyl-2-imidazol-1-yl-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 5096428 |
| Molecular Formula | C22H17F3N3PS |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-diphenylphosphinothioyl-2-imidazol-1-yl-5-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(-n2ccnc2)c(NP(=S)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17F3N3PS/c23-22(24,25)17-11-12-21(28-14-13-26-16-28)20(15-17)27-29(30,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-16H,(H,27,30) |
| InChIKey | DTVVUPXXNBNLNL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|