C15H20N4O2 — CID 50964401
7-(2,5-dihydro-1H-pyrrole-2-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 50964401) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 7-(2,5-dihydro-1H-pyrrole-2-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-(2,5-dihydro-1H-pyrrole-2-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 50964401 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 7-(2,5-dihydro-1H-pyrrole-2-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)C1C=CCN1)CC2 |
| InChI | InChI=1S/C15H20N4O2/c1-10-17-12-6-9-19(15(21)13-4-3-7-16-13)8-5-11(12)14(20)18(10)2/h3-4,13,16H,5-9H2,1-2H3 |
| InChIKey | NOSNJTAAQYNKSA-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|