About 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole
2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole (PubChem CID 50964547) has the molecular formula C17H14FN7
and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole.
Molecular Properties
| Compound Name | 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole |
| PubChem CID | 50964547 |
| Molecular Formula | C17H14FN7 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole |
| SMILES | Fc1ccc(-c2nnn(Cc3nc(Cc4ccccc4)n[nH]3)n2)cc1 |
| InChI | InChI=1S/C17H14FN7/c18-14-8-6-13(7-9-14)17-22-24-25(23-17)11-16-19-15(20-21-16)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,20,21) |
| InChIKey | RLEFQPMDJYFOSL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole?
The IUPAC name of 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole (CID 50964547) is 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole.
What is the SMILES notation for 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole?
The canonical SMILES for 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole is Fc1ccc(-c2nnn(Cc3nc(Cc4ccccc4)n[nH]3)n2)cc1.
What is the InChIKey of 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole?
The InChIKey is RLEFQPMDJYFOSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN7/c18-14-8-6-13(7-9-14)17-22-24-25(23-17)11-16-19-15(20-21-16)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,20,21).
What are the key properties of 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole?
2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole has a molecular weight of 335.35 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-benzyl-1H-1,2,4-triazol-5-yl)methyl]-5-(4-fluorophenyl)tetrazole is sourced from PubChem (CID 50964547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).