C17H31N7O — CID 50964709
2-[4-[2-amino-6-(diethylamino)pyrimidin-4-yl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 50964709) has the molecular formula C17H31N7O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[4-[2-amino-6-(diethylamino)pyrimidin-4-yl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[2-amino-6-(diethylamino)pyrimidin-4-yl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 50964709 |
| Molecular Formula | C17H31N7O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 2-[4-[2-amino-6-(diethylamino)pyrimidin-4-yl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CCN(CC)c1cc(N2CCN(CC(=O)NC(C)C)CC2)nc(N)n1 |
| InChI | InChI=1S/C17H31N7O/c1-5-23(6-2)14-11-15(21-17(18)20-14)24-9-7-22(8-10-24)12-16(25)19-13(3)4/h11,13H,5-10,12H2,1-4H3,(H,19,25)(H2,18,20,21) |
| InChIKey | UAFWGJGMCFXNOI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |