C19H19N5O3 — CID 50965420
2-[2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]-6-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 50965420) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]-6-phenyl-4,5-dihydropyridazin-3-one.
| Compound Name | 2-[2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]-6-phenyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 50965420 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methylamino]ethyl]-6-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | O=C1CCC(c2ccccc2)=NN1CCNCc1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C19H19N5O3/c25-18-9-8-15(14-5-2-1-3-6-14)22-24(18)11-10-20-13-17-21-19(23-27-17)16-7-4-12-26-16/h1-7,12,20H,8-11,13H2 |
| InChIKey | WSSDMJYXCILPKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|