About [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol
[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol (PubChem CID 50965548) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol.
Molecular Properties
| Compound Name | [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol |
| PubChem CID | 50965548 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol |
| SMILES | OCc1nc2ccc(-c3ccc4c(c3)OCCO4)cc2[nH]1 |
| InChI | InChI=1S/C16H14N2O3/c19-9-16-17-12-3-1-10(7-13(12)18-16)11-2-4-14-15(8-11)21-6-5-20-14/h1-4,7-8,19H,5-6,9H2,(H,17,18) |
| InChIKey | OBLHYQNJWIXGQL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol?
The IUPAC name of [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol (CID 50965548) is [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol.
What is the SMILES notation for [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol?
The canonical SMILES for [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol is OCc1nc2ccc(-c3ccc4c(c3)OCCO4)cc2[nH]1.
What is the InChIKey of [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol?
The InChIKey is OBLHYQNJWIXGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c19-9-16-17-12-3-1-10(7-13(12)18-16)11-2-4-14-15(8-11)21-6-5-20-14/h1-4,7-8,19H,5-6,9H2,(H,17,18).
What are the key properties of [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol?
[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol has a molecular weight of 282.30 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]methanol is sourced from PubChem (CID 50965548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).