About 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one
1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one (PubChem CID 50965612) has the molecular formula C22H28N2O2
and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one |
| PubChem CID | 50965612 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCCC1)N1CC[C@@H](c2ccc3ccccc3c2)[C@H](O)C1 |
| InChI | InChI=1S/C22H28N2O2/c25-21-16-24(22(26)10-13-23-11-3-4-12-23)14-9-20(21)19-8-7-17-5-1-2-6-18(17)15-19/h1-2,5-8,15,20-21,25H,3-4,9-14,16H2/t20-,21+/m0/s1 |
| InChIKey | RHOAMTGWCHDYKZ-LEWJYISDSA-N |
| XLogP | 3.00 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one?
The IUPAC name of 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one (CID 50965612) is 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one.
What is the SMILES notation for 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one?
The canonical SMILES for 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one is O=C(CCN1CCCC1)N1CC[C@@H](c2ccc3ccccc3c2)[C@H](O)C1.
What is the InChIKey of 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one?
The InChIKey is RHOAMTGWCHDYKZ-LEWJYISDSA-N. The full InChI is InChI=1S/C22H28N2O2/c25-21-16-24(22(26)10-13-23-11-3-4-12-23)14-9-20(21)19-8-7-17-5-1-2-6-18(17)15-19/h1-2,5-8,15,20-21,25H,3-4,9-14,16H2/t20-,21+/m0/s1.
What are the key properties of 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one?
1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one has a molecular weight of 352.48 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-3-pyrrolidin-1-ylpropan-1-one is sourced from PubChem (CID 50965612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).