About N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide
N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide (PubChem CID 50965740) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
| PubChem CID | 50965740 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
| SMILES | CCc1nc(C)sc1CN1CCC=C(CNC(C)=O)C1 |
| InChI | InChI=1S/C15H23N3OS/c1-4-14-15(20-12(3)17-14)10-18-7-5-6-13(9-18)8-16-11(2)19/h6H,4-5,7-10H2,1-3H3,(H,16,19) |
| InChIKey | BXRWPWXSPPWQFH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide?
The IUPAC name of N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide (CID 50965740) is N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide.
What is the SMILES notation for N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide?
The canonical SMILES for N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide is CCc1nc(C)sc1CN1CCC=C(CNC(C)=O)C1.
What is the InChIKey of N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide?
The InChIKey is BXRWPWXSPPWQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-4-14-15(20-12(3)17-14)10-18-7-5-6-13(9-18)8-16-11(2)19/h6H,4-5,7-10H2,1-3H3,(H,16,19).
What are the key properties of N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide?
N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide has a molecular weight of 293.44 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide is sourced from PubChem (CID 50965740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).