C17H20N6O — CID 50966599
2-[[2-amino-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]ethanol (PubChem CID 50966599) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-[[2-amino-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-amino-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 50966599 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[[2-amino-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-4-yl]amino]ethanol |
| SMILES | Nc1nc(NCCO)cc(N2CCc3c([nH]c4ccccc34)C2)n1 |
| InChI | InChI=1S/C17H20N6O/c18-17-21-15(19-6-8-24)9-16(22-17)23-7-5-12-11-3-1-2-4-13(11)20-14(12)10-23/h1-4,9,20,24H,5-8,10H2,(H3,18,19,21,22) |
| InChIKey | MRGPAEWJUDNBAO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|