C20H26N4O2 — CID 50967299
10-methoxy-5-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2,3,4,6-tetrahydro-1,5-benzoxazocine (PubChem CID 50967299) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 10-methoxy-5-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2,3,4,6-tetrahydro-1,5-benzoxazocine.
| Compound Name | 10-methoxy-5-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2,3,4,6-tetrahydro-1,5-benzoxazocine |
|---|---|
| PubChem CID | 50967299 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 10-methoxy-5-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)-2,3,4,6-tetrahydro-1,5-benzoxazocine |
| SMILES | COc1cccc2c1OCCCN(c1nc(C)nc3c1CCNCC3)C2 |
| InChI | InChI=1S/C20H26N4O2/c1-14-22-17-8-10-21-9-7-16(17)20(23-14)24-11-4-12-26-19-15(13-24)5-3-6-18(19)25-2/h3,5-6,21H,4,7-13H2,1-2H3 |
| InChIKey | PKVOLDYLIRNKBV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |