C18H30N4O — CID 50967394
N,2,7-trimethyl-N-[2-(oxan-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 50967394) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is N,2,7-trimethyl-N-[2-(oxan-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | N,2,7-trimethyl-N-[2-(oxan-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 50967394 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N,2,7-trimethyl-N-[2-(oxan-2-yl)ethyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1nc2c(c(N(C)CCC3CCCCO3)n1)CCN(C)CC2 |
| InChI | InChI=1S/C18H30N4O/c1-14-19-17-9-11-21(2)10-8-16(17)18(20-14)22(3)12-7-15-6-4-5-13-23-15/h15H,4-13H2,1-3H3 |
| InChIKey | SMZCPAXRVHMCQD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |