C18H26N4O2 — CID 50967554
7-[2-[(1R,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 50967554) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 7-[2-[(1R,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[2-[(1R,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 50967554 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 7-[2-[(1R,4R)-2-azabicyclo[2.2.1]heptan-2-yl]acetyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)CN1C[C@@H]3CC[C@@H]1C3)CC2 |
| InChI | InChI=1S/C18H26N4O2/c1-12-19-16-6-8-21(7-5-15(16)18(24)20(12)2)17(23)11-22-10-13-3-4-14(22)9-13/h13-14H,3-11H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | FZTGODXQMNFBDA-ZIAGYGMSSA-N |
| XLogP | 0.50 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |