About N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide
N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide (PubChem CID 50967761) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide.
Molecular Properties
| Compound Name | N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide |
| PubChem CID | 50967761 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide |
| SMILES | CCOCCN1CC=C(CN(CC)C(C)=O)CC1 |
| InChI | InChI=1S/C14H26N2O2/c1-4-16(13(3)17)12-14-6-8-15(9-7-14)10-11-18-5-2/h6H,4-5,7-12H2,1-3H3 |
| InChIKey | LFKFMARFRNLOFA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide?
The IUPAC name of N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide (CID 50967761) is N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide.
What is the SMILES notation for N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide?
The canonical SMILES for N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide is CCOCCN1CC=C(CN(CC)C(C)=O)CC1.
What is the InChIKey of N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide?
The InChIKey is LFKFMARFRNLOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-4-16(13(3)17)12-14-6-8-15(9-7-14)10-11-18-5-2/h6H,4-5,7-12H2,1-3H3.
What are the key properties of N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide?
N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide has a molecular weight of 254.37 g/mol, XLogP of 1.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-4-yl]methyl]-N-ethylacetamide is sourced from PubChem (CID 50967761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).