About 2,4-diphenyl-5H-chromeno[4,3-b]pyridine
2,4-diphenyl-5H-chromeno[4,3-b]pyridine (PubChem CID 5096779) has the molecular formula C24H17NO
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2,4-diphenyl-5H-chromeno[4,3-b]pyridine.
Molecular Properties
| Compound Name | 2,4-diphenyl-5H-chromeno[4,3-b]pyridine |
| PubChem CID | 5096779 |
| Molecular Formula | C24H17NO |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2,4-diphenyl-5H-chromeno[4,3-b]pyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3c(n2)-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C24H17NO/c1-3-9-17(10-4-1)20-15-22(18-11-5-2-6-12-18)25-24-19-13-7-8-14-23(19)26-16-21(20)24/h1-15H,16H2 |
| InChIKey | LAJOKXIZSXPGTE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-diphenyl-5H-chromeno[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-5H-chromeno[4,3-b]pyridine?
The IUPAC name of 2,4-diphenyl-5H-chromeno[4,3-b]pyridine (CID 5096779) is 2,4-diphenyl-5H-chromeno[4,3-b]pyridine.
What is the SMILES notation for 2,4-diphenyl-5H-chromeno[4,3-b]pyridine?
The canonical SMILES for 2,4-diphenyl-5H-chromeno[4,3-b]pyridine is c1ccc(-c2cc(-c3ccccc3)c3c(n2)-c2ccccc2OC3)cc1.
What is the InChIKey of 2,4-diphenyl-5H-chromeno[4,3-b]pyridine?
The InChIKey is LAJOKXIZSXPGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO/c1-3-9-17(10-4-1)20-15-22(18-11-5-2-6-12-18)25-24-19-13-7-8-14-23(19)26-16-21(20)24/h1-15H,16H2.
What are the key properties of 2,4-diphenyl-5H-chromeno[4,3-b]pyridine?
2,4-diphenyl-5H-chromeno[4,3-b]pyridine has a molecular weight of 335.41 g/mol, XLogP of 5.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-5H-chromeno[4,3-b]pyridine is sourced from PubChem (CID 5096779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).