C19H32N2O2 — CID 50967878
3-[[4-[(4-methoxy-4-methylpentan-2-yl)amino]piperidin-1-yl]methyl]phenol (PubChem CID 50967878) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 3-[[4-[(4-methoxy-4-methylpentan-2-yl)amino]piperidin-1-yl]methyl]phenol.
| Compound Name | 3-[[4-[(4-methoxy-4-methylpentan-2-yl)amino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 50967878 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 3-[[4-[(4-methoxy-4-methylpentan-2-yl)amino]piperidin-1-yl]methyl]phenol |
| SMILES | COC(C)(C)CC(C)NC1CCN(Cc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C19H32N2O2/c1-15(13-19(2,3)23-4)20-17-8-10-21(11-9-17)14-16-6-5-7-18(22)12-16/h5-7,12,15,17,20,22H,8-11,13-14H2,1-4H3 |
| InChIKey | GYSWBSQGTAWIEB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |