About N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide
N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide (PubChem CID 50968242) has the molecular formula C18H30N4O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide.
Molecular Properties
| Compound Name | N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide |
| PubChem CID | 50968242 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide |
| SMILES | CN(Cc1cc(C(C)(C)C)n[nH]1)C(=O)CCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H30N4O2/c1-18(2,3)15-11-14(20-21-15)12-22(4)17(24)10-9-16(23)19-13-7-5-6-8-13/h11,13H,5-10,12H2,1-4H3,(H,19,23)(H,20,21) |
| InChIKey | KLPLOWFDQJDLTB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide?
The IUPAC name of N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide (CID 50968242) is N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide.
What is the SMILES notation for N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide?
The canonical SMILES for N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide is CN(Cc1cc(C(C)(C)C)n[nH]1)C(=O)CCC(=O)NC1CCCC1.
What is the InChIKey of N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide?
The InChIKey is KLPLOWFDQJDLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O2/c1-18(2,3)15-11-14(20-21-15)12-22(4)17(24)10-9-16(23)19-13-7-5-6-8-13/h11,13H,5-10,12H2,1-4H3,(H,19,23)(H,20,21).
What are the key properties of N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide?
N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide has a molecular weight of 334.46 g/mol, XLogP of 2.50, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-N-cyclopentyl-N'-methylbutanediamide is sourced from PubChem (CID 50968242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).