About 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine
4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine (PubChem CID 50968675) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine |
| PubChem CID | 50968675 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine |
| SMILES | c1ccc(C(Cn2cnnc2)N2CCOCC2)nc1 |
| InChI | InChI=1S/C13H17N5O/c1-2-4-14-12(3-1)13(9-17-10-15-16-11-17)18-5-7-19-8-6-18/h1-4,10-11,13H,5-9H2 |
| InChIKey | CJJYQRUGLOIVCE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine?
The IUPAC name of 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine (CID 50968675) is 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine.
What is the SMILES notation for 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine?
The canonical SMILES for 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine is c1ccc(C(Cn2cnnc2)N2CCOCC2)nc1.
What is the InChIKey of 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine?
The InChIKey is CJJYQRUGLOIVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-2-4-14-12(3-1)13(9-17-10-15-16-11-17)18-5-7-19-8-6-18/h1-4,10-11,13H,5-9H2.
What are the key properties of 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine?
4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine has a molecular weight of 259.31 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-pyridin-2-yl-2-(1,2,4-triazol-4-yl)ethyl]morpholine is sourced from PubChem (CID 50968675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).