C12H23N3O2 — CID 50968689
N-(2-propoxyethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50968689) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-(2-propoxyethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | N-(2-propoxyethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50968689 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-(2-propoxyethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CCCOCCNC(=O)C12CNCC1CNC2 |
| InChI | InChI=1S/C12H23N3O2/c1-2-4-17-5-3-15-11(16)12-8-13-6-10(12)7-14-9-12/h10,13-14H,2-9H2,1H3,(H,15,16) |
| InChIKey | LGQXDPRWZYSVEO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|