C17H26N6O — CID 50969021
1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 50969021) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 50969021 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | Cc1cc(C)n(CCCNc2nccc(N3CCC(O)CC3)n2)n1 |
| InChI | InChI=1S/C17H26N6O/c1-13-12-14(2)23(21-13)9-3-7-18-17-19-8-4-16(20-17)22-10-5-15(24)6-11-22/h4,8,12,15,24H,3,5-7,9-11H2,1-2H3,(H,18,19,20) |
| InChIKey | ZSNMUSAOYJACON-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|