C14H21N5 — CID 50970028
5-ethyl-2-methyl-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]pyrimidin-4-amine (PubChem CID 50970028) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 5-ethyl-2-methyl-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]pyrimidin-4-amine.
| Compound Name | 5-ethyl-2-methyl-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 50970028 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 5-ethyl-2-methyl-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]pyrimidin-4-amine |
| SMILES | CCc1cnc(C)nc1NC(C)Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/C14H21N5/c1-5-12-8-15-11(4)17-14(12)16-9(2)6-13-7-10(3)18-19-13/h7-9H,5-6H2,1-4H3,(H,18,19)(H,15,16,17) |
| InChIKey | OLESLJUQQZKSPI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |