About (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol
(3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol (PubChem CID 50970348) has the molecular formula C17H21ClFN3O
and a molecular weight of 337.83 g/mol. Its IUPAC name is (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol |
| PubChem CID | 50970348 |
| Molecular Formula | C17H21ClFN3O |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol |
| SMILES | Cc1nn(C)c(Cl)c1CN1CC[C@@H](c2ccc(F)cc2)[C@H](O)C1 |
| InChI | InChI=1S/C17H21ClFN3O/c1-11-15(17(18)21(2)20-11)9-22-8-7-14(16(23)10-22)12-3-5-13(19)6-4-12/h3-6,14,16,23H,7-10H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | LZDSMDWANWFDQH-GOEBONIOSA-N |
| XLogP | 2.87 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol?
The IUPAC name of (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol (CID 50970348) is (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol.
What is the SMILES notation for (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol?
The canonical SMILES for (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol is Cc1nn(C)c(Cl)c1CN1CC[C@@H](c2ccc(F)cc2)[C@H](O)C1.
What is the InChIKey of (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol?
The InChIKey is LZDSMDWANWFDQH-GOEBONIOSA-N. The full InChI is InChI=1S/C17H21ClFN3O/c1-11-15(17(18)21(2)20-11)9-22-8-7-14(16(23)10-22)12-3-5-13(19)6-4-12/h3-6,14,16,23H,7-10H2,1-2H3/t14-,16+/m0/s1.
What are the key properties of (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol?
(3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol has a molecular weight of 337.83 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(4-fluorophenyl)piperidin-3-ol is sourced from PubChem (CID 50970348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).