About 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine
6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine (PubChem CID 50970575) has the molecular formula C17H26N6O
and a molecular weight of 330.44 g/mol. Its IUPAC name is 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine |
| PubChem CID | 50970575 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine |
| SMILES | CCc1cc(N(C)Cc2nnc(CC)o2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C17H26N6O/c1-4-13-11-14(19-17(18-13)23-9-7-6-8-10-23)22(3)12-16-21-20-15(5-2)24-16/h11H,4-10,12H2,1-3H3 |
| InChIKey | ACGQOXHPQCNZRB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine?
The IUPAC name of 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine (CID 50970575) is 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine?
The canonical SMILES for 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine is CCc1cc(N(C)Cc2nnc(CC)o2)nc(N2CCCCC2)n1.
What is the InChIKey of 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine?
The InChIKey is ACGQOXHPQCNZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6O/c1-4-13-11-14(19-17(18-13)23-9-7-6-8-10-23)22(3)12-16-21-20-15(5-2)24-16/h11H,4-10,12H2,1-3H3.
What are the key properties of 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine?
6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine has a molecular weight of 330.44 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-piperidin-1-ylpyrimidin-4-amine is sourced from PubChem (CID 50970575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).