About 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine
4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine (PubChem CID 50970607) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine |
| PubChem CID | 50970607 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine |
| SMILES | Cc1noc(-c2ccnc(-c3ccc(C(C)N4CCOCC4)cc3)c2)n1 |
| InChI | InChI=1S/C20H22N4O2/c1-14(24-9-11-25-12-10-24)16-3-5-17(6-4-16)19-13-18(7-8-21-19)20-22-15(2)23-26-20/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | QMUDYBFYHPDNKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine?
The IUPAC name of 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine (CID 50970607) is 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine.
What is the SMILES notation for 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine?
The canonical SMILES for 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine is Cc1noc(-c2ccnc(-c3ccc(C(C)N4CCOCC4)cc3)c2)n1.
What is the InChIKey of 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine?
The InChIKey is QMUDYBFYHPDNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-14(24-9-11-25-12-10-24)16-3-5-17(6-4-16)19-13-18(7-8-21-19)20-22-15(2)23-26-20/h3-8,13-14H,9-12H2,1-2H3.
What are the key properties of 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine?
4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine has a molecular weight of 350.42 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]ethyl]morpholine is sourced from PubChem (CID 50970607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).