C21H29N5 — CID 50970675
N,2-dimethyl-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 50970675) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is N,2-dimethyl-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N,2-dimethyl-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 50970675 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N,2-dimethyl-N-[(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | Cc1nc2c(c(N(C)CC3Cc4ccccc4CN3C)n1)CCNCC2 |
| InChI | InChI=1S/C21H29N5/c1-15-23-20-9-11-22-10-8-19(20)21(24-15)26(3)14-18-12-16-6-4-5-7-17(16)13-25(18)2/h4-7,18,22H,8-14H2,1-3H3 |
| InChIKey | LWDHSQLPNDLWKJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |