C20H25N3O2 — CID 50970966
N-[(2S,4R,6S)-2-benzyl-6-[2-(methylamino)-3-pyridinyl]oxan-4-yl]acetamide (PubChem CID 50970966) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(2S,4R,6S)-2-benzyl-6-[2-(methylamino)-3-pyridinyl]oxan-4-yl]acetamide.
| Compound Name | N-[(2S,4R,6S)-2-benzyl-6-[2-(methylamino)-3-pyridinyl]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 50970966 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(2S,4R,6S)-2-benzyl-6-[2-(methylamino)-3-pyridinyl]oxan-4-yl]acetamide |
| SMILES | CNc1ncccc1[C@@H]1C[C@H](NC(C)=O)C[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C20H25N3O2/c1-14(24)23-16-12-17(11-15-7-4-3-5-8-15)25-19(13-16)18-9-6-10-22-20(18)21-2/h3-10,16-17,19H,11-13H2,1-2H3,(H,21,22)(H,23,24)/t16-,17+,19+/m1/s1 |
| InChIKey | SNDUSLBVGUQOQH-AOIWGVFYSA-N |
| XLogP | 3.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |