C21H24N2O3 — CID 50970975
[4-[[(5-methoxy-1H-indol-2-yl)methylamino]methyl]-2,6-dimethylphenyl] acetate (PubChem CID 50970975) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [4-[[(5-methoxy-1H-indol-2-yl)methylamino]methyl]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[[(5-methoxy-1H-indol-2-yl)methylamino]methyl]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 50970975 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [4-[[(5-methoxy-1H-indol-2-yl)methylamino]methyl]-2,6-dimethylphenyl] acetate |
| SMILES | COc1ccc2[nH]c(CNCc3cc(C)c(OC(C)=O)c(C)c3)cc2c1 |
| InChI | InChI=1S/C21H24N2O3/c1-13-7-16(8-14(2)21(13)26-15(3)24)11-22-12-18-9-17-10-19(25-4)5-6-20(17)23-18/h5-10,22-23H,11-12H2,1-4H3 |
| InChIKey | DELLVVFVMDGQIQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|