C20H18N2O4 — CID 50971172
N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide (PubChem CID 50971172) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide.
| Compound Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 50971172 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)NCc2cc(-c3ccco3)on2)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-20(2,24)10-9-14-5-7-15(8-6-14)19(23)21-13-16-12-18(26-22-16)17-4-3-11-25-17/h3-8,11-12,24H,13H2,1-2H3,(H,21,23) |
| InChIKey | CXQKWKHHRATLSM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|