C14H17N7S — CID 50971267
2-(2-aminoethyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinazolin-4-amine (PubChem CID 50971267) has the molecular formula C14H17N7S and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinazolin-4-amine.
| Compound Name | 2-(2-aminoethyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 50971267 |
| Molecular Formula | C14H17N7S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-(2-aminoethyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]quinazolin-4-amine |
| SMILES | NCCc1nc(NCCSc2ncn[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C14H17N7S/c15-6-5-12-19-11-4-2-1-3-10(11)13(20-12)16-7-8-22-14-17-9-18-21-14/h1-4,9H,5-8,15H2,(H,16,19,20)(H,17,18,21) |
| InChIKey | GAVHMNBMFPHFEC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|