About 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide
5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 50971334) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide |
| PubChem CID | 50971334 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | Cc1nn(-c2cncc(C(N)=O)c2)c(C)c1-c1ccccc1O |
| InChI | InChI=1S/C17H16N4O2/c1-10-16(14-5-3-4-6-15(14)22)11(2)21(20-10)13-7-12(17(18)23)8-19-9-13/h3-9,22H,1-2H3,(H2,18,23) |
| InChIKey | KKXPFOKNLORNBM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide?
The IUPAC name of 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide (CID 50971334) is 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide.
What is the SMILES notation for 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide?
The canonical SMILES for 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide is Cc1nn(-c2cncc(C(N)=O)c2)c(C)c1-c1ccccc1O.
What is the InChIKey of 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide?
The InChIKey is KKXPFOKNLORNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c1-10-16(14-5-3-4-6-15(14)22)11(2)21(20-10)13-7-12(17(18)23)8-19-9-13/h3-9,22H,1-2H3,(H2,18,23).
What are the key properties of 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide?
5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide has a molecular weight of 308.34 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2-hydroxyphenyl)-3,5-dimethylpyrazol-1-yl]pyridine-3-carboxamide is sourced from PubChem (CID 50971334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).