About ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate
ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 50971536) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate |
| PubChem CID | 50971536 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc(N(C)C)nc(C)c2C)CC1 |
| InChI | InChI=1S/C16H27N5O2/c1-6-23-16(22)21-9-7-13(8-10-21)18-14-11(2)12(3)17-15(19-14)20(4)5/h13H,6-10H2,1-5H3,(H,17,18,19) |
| InChIKey | ZMTUZUPRDQVXRF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate (CID 50971536) is ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate is CCOC(=O)N1CCC(Nc2nc(N(C)C)nc(C)c2C)CC1.
What is the InChIKey of ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate?
The InChIKey is ZMTUZUPRDQVXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O2/c1-6-23-16(22)21-9-7-13(8-10-21)18-14-11(2)12(3)17-15(19-14)20(4)5/h13H,6-10H2,1-5H3,(H,17,18,19).
What are the key properties of ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate?
ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate has a molecular weight of 321.43 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 50971536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).