C16H29N5 — CID 50971805
4-N-ethyl-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 50971805) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-N-ethyl-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 50971805 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 4-N-ethyl-2-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ccnc(NC2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C16H29N5/c1-7-17-13-8-9-18-14(20-13)19-12-10-15(2,3)21(6)16(4,5)11-12/h8-9,12H,7,10-11H2,1-6H3,(H2,17,18,19,20) |
| InChIKey | BLLKZLHERKSEED-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |