C17H28N4OS — CID 50972646
N-cyclohexyl-N-(2-ethylsulfanylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxamide (PubChem CID 50972646) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is N-cyclohexyl-N-(2-ethylsulfanylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-N-(2-ethylsulfanylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50972646 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-cyclohexyl-N-(2-ethylsulfanylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carboxamide |
| SMILES | CCSCCN(C(=O)c1nnc2n1CCCC2)C1CCCCC1 |
| InChI | InChI=1S/C17H28N4OS/c1-2-23-13-12-20(14-8-4-3-5-9-14)17(22)16-19-18-15-10-6-7-11-21(15)16/h14H,2-13H2,1H3 |
| InChIKey | BHRUTJPQZQTMNP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|