C16H25N3O2 — CID 50973061
[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-5-methylpyrazol-4-yl)methanone (PubChem CID 50973061) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-5-methylpyrazol-4-yl)methanone.
| Compound Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-5-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 50973061 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-5-methylpyrazol-4-yl)methanone |
| SMILES | CCn1ncc(C(=O)N2CC[C@@]3(O)CCCC[C@H]3C2)c1C |
| InChI | InChI=1S/C16H25N3O2/c1-3-19-12(2)14(10-17-19)15(20)18-9-8-16(21)7-5-4-6-13(16)11-18/h10,13,21H,3-9,11H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | VLNHCVRAYQQLRH-BBRMVZONSA-N |
| XLogP | 1.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |