About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine (PubChem CID 50973795) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine |
| PubChem CID | 50973795 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine |
| SMILES | Cc1noc(C)c1CN(C)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-15(12(2)20-16-11)10-17(3)9-13-5-7-14(8-6-13)21(4,18)19/h5-8H,9-10H2,1-4H3 |
| InChIKey | QADHTHILKPXYJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine (CID 50973795) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine is Cc1noc(C)c1CN(C)Cc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine?
The InChIKey is QADHTHILKPXYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-11-15(12(2)20-16-11)10-17(3)9-13-5-7-14(8-6-13)21(4,18)19/h5-8H,9-10H2,1-4H3.
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine has a molecular weight of 308.40 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-1-(4-methylsulfonylphenyl)methanamine is sourced from PubChem (CID 50973795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).