C17H17F4N3O — CID 50974029
4-(1-methylpyrazol-4-yl)-1-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 50974029) has the molecular formula C17H17F4N3O and a molecular weight of 355.34 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-1-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(1-methylpyrazol-4-yl)-1-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 50974029 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-1-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | COc1c(F)c(F)c(CN2CC=C(c3cnn(C)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C17H17F4N3O/c1-23-8-11(7-22-23)10-3-5-24(6-4-10)9-12-13(18)15(20)17(25-2)16(21)14(12)19/h3,7-8H,4-6,9H2,1-2H3 |
| InChIKey | JBVSWVMKHHJESK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|