C16H25N5O — CID 50974126
2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 50974126) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 50974126 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CCC(c2nncn2C)CC1 |
| InChI | InChI=1S/C16H25N5O/c1-4-8-21(9-5-2)15(22)12-20-10-6-14(7-11-20)16-18-17-13-19(16)3/h4-5,13-14H,1-2,6-12H2,3H3 |
| InChIKey | GIQHWZPXHTXPMW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|