About N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide
N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide (PubChem CID 50974207) has the molecular formula C16H17ClFN3O2S
and a molecular weight of 369.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide.
Molecular Properties
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide |
| PubChem CID | 50974207 |
| Molecular Formula | C16H17ClFN3O2S |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide |
| SMILES | CC(c1nccs1)N(C)C(=O)CCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClFN3O2S/c1-10(16-19-7-8-24-16)21(2)15(23)6-5-14(22)20-11-3-4-13(18)12(17)9-11/h3-4,7-10H,5-6H2,1-2H3,(H,20,22) |
| InChIKey | ZVPXIPDUDSZACJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide?
The IUPAC name of N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide (CID 50974207) is N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide.
What is the SMILES notation for N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide?
The canonical SMILES for N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide is CC(c1nccs1)N(C)C(=O)CCC(=O)Nc1ccc(F)c(Cl)c1.
What is the InChIKey of N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide?
The InChIKey is ZVPXIPDUDSZACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClFN3O2S/c1-10(16-19-7-8-24-16)21(2)15(23)6-5-14(22)20-11-3-4-13(18)12(17)9-11/h3-4,7-10H,5-6H2,1-2H3,(H,20,22).
What are the key properties of N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide?
N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide has a molecular weight of 369.85 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-fluorophenyl)-N'-methyl-N'-[1-(1,3-thiazol-2-yl)ethyl]butanediamide is sourced from PubChem (CID 50974207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).